CAS 13710-47-9 appears in our catalog under these names: 3-(Perfluoroethyl)benzoic acid, 95+%, 3-(Pentafluoroethyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(1,1,2,2,2-pentafluoroethyl)benzoic acid (CAS 13710-47-9) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 3-(1,1,2,2,2-pentafluoroethyl)benzoic acid. InChIKey: RSZIYFMYMSOUTH-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 3-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| InChIKey | RSZIYFMYMSOUTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(C(F)(F)F)(F)F)C(=O)O |
Computed by PubChem (NCBI)