CAS 383-13-1 appears in our catalog under these names: 4-(1,1,2,2,2-Pentafluoroethyl)benzoic acid, 4-(1,1,2,2,2-PENTAFLUOROETHYL)BENZOIC A&. Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 100mg, 500MG.
4-(1,1,2,2,2-pentafluoroethyl)benzoic acid (CAS 383-13-1) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 4-(1,1,2,2,2-pentafluoroethyl)benzoic acid. InChIKey: WJKRCWXOKSNIAD-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| InChIKey | WJKRCWXOKSNIAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)