CAS 1443666-12-3 is the registry number for 3,5-Difluoro-4-(2,2,2-trifluoroethoxy)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3,5-difluoro-4-(2,2,2-trifluoroethoxy)benzaldehyde (CAS 1443666-12-3) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 3,5-difluoro-4-(2,2,2-trifluoroethoxy)benzaldehyde. InChIKey: RJWIPMRNBRXFOX-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 3,5-difluoro-4-(2,2,2-trifluoroethoxy)benzaldehyde |
| InChIKey | RJWIPMRNBRXFOX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OCC(F)(F)F)F)C=O |
Computed by PubChem (NCBI)