Products 247113-95-7

CAS 247113-95-7 is the registry number for 2,3-Difluoro-4-(trifluoromethyl)phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[2,3-difluoro-4-(trifluoromethyl)phenyl]acetic acid (CAS 247113-95-7) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 2-[2,3-difluoro-4-(trifluoromethyl)phenyl]acetic acid. InChIKey: FIEZAAANOPOSLH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5F5O2
Molecular weight240.13 g/mol
IUPAC name2-[2,3-difluoro-4-(trifluoromethyl)phenyl]acetic acid
InChIKeyFIEZAAANOPOSLH-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1CC(=O)O)F)F)C(F)(F)F

Computed by PubChem (NCBI)