Products 1330180-47-6
CAS 1330180-47-6 is the registry number for 4-(4-Nitrophenyl)-3-morpholinone-d4. Offered by: TRC. Available pack sizes: 100mg, 10mg.
4-(2,3,5,6-tetradeuterio-4-nitrophenyl)morpholin-3-one (CAS 1330180-47-6) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 226.22 g/mol. IUPAC name: 4-(2,3,5,6-tetradeuterio-4-nitrophenyl)morpholin-3-one. InChIKey: OWMGEFWSGOTGAU-RHQRLBAQSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 4-(2,3,5,6-tetradeuterio-4-nitrophenyl)morpholin-3-one |
| InChIKey | OWMGEFWSGOTGAU-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N2CCOCC2=O)[2H])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)