Products 887595-94-0
CAS 887595-94-0 is the registry number for 1-(2-Nitrophenyl)azetidine-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
1-(2-nitrophenyl)azetidine-3-carboxylic acid (CAS 887595-94-0) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 1-(2-nitrophenyl)azetidine-3-carboxylic acid. InChIKey: IVELCXUDFCVTMA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 1-(2-nitrophenyl)azetidine-3-carboxylic acid |
| InChIKey | IVELCXUDFCVTMA-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=CC=CC=C2[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)