CAS 291528-35-3 appears in our catalog under these names: 4-(Cyclopropylamino)-3-nitrobenzoic acid, 95%, 4-(Cyclopropylamino)-3-nitrobenzoic acid, 99%, 99%, WAY–622024, GPCR agonist-2, GPCR agonist-2, 99.93%. Offered by: Combi-blocks, Chemat, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 50mg, 500mg, 10mg.
4-(cyclopropylamino)-3-nitrobenzoic acid (CAS 291528-35-3) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 4-(cyclopropylamino)-3-nitrobenzoic acid. InChIKey: IKTICLQCJRBVRS-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 4-(cyclopropylamino)-3-nitrobenzoic acid |
| InChIKey | IKTICLQCJRBVRS-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)