Products 14612-22-7
CAS 14612-22-7 is the registry number for 1,7-Diazatricyclo[7.3.0.0(3,7)]dodecane-2,6,8,12-tetrone, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,7-diazatricyclo[7.3.0.03,7]dodecane-2,6,8,12-tetrone (CAS 14612-22-7) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 1,7-diazatricyclo[7.3.0.03,7]dodecane-2,6,8,12-tetrone. InChIKey: TXFYQWADOFKHHB-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 1,7-diazatricyclo[7.3.0.03,7]dodecane-2,6,8,12-tetrone |
| InChIKey | TXFYQWADOFKHHB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N2C1C(=O)N3C(C2=O)CCC3=O |
Computed by PubChem (NCBI)