Products 25936-17-8
CAS 25936-17-8 is the registry number for 6-Nitro-3-propyl-1,3-benzoxazol-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
6-nitro-3-propyl-1,3-benzoxazol-2-one (CAS 25936-17-8) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 6-nitro-3-propyl-1,3-benzoxazol-2-one. InChIKey: ISQRICLAHYLKQY-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 6-nitro-3-propyl-1,3-benzoxazol-2-one |
| InChIKey | ISQRICLAHYLKQY-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C=C(C=C2)[N+](=O)[O-])OC1=O |
Computed by PubChem (NCBI)