CAS 4835-39-6 appears in our catalog under these names: N-(4-Nitrophenyl)-3-oxobutanamide, 95%, N-(4-Nitrophenyl)-3-oxobutanamide, 95+%, N–(4–Nitrophenyl)–3–oxobutyramide, N-(4-Nitrophenyl)-3-oxobutyramide, >98.0%(HPLC)(T). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 250mg, 1g, 200mg.
N-(4-nitrophenyl)-3-oxobutanamide (CAS 4835-39-6) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: N-(4-nitrophenyl)-3-oxobutanamide. InChIKey: KCXJQNDNGLRYBN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | N-(4-nitrophenyl)-3-oxobutanamide |
| InChIKey | KCXJQNDNGLRYBN-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)