CAS 1059195-96-8 appears in our catalog under these names: Methyl 2-(1,3-dioxo-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-4-yl)acetate, 95%, Methyl 2-(1,3-dioxo-1,2,3,4-tetrahydropyrrolo(1,2-a)pyrazin-4-yl)acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetate (CAS 1059195-96-8) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: methyl 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetate. InChIKey: DYPKUMVHMDDLOH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | methyl 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetate |
| InChIKey | DYPKUMVHMDDLOH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1C(=O)NC(=O)C2=CC=CN12 |
Computed by PubChem (NCBI)