Products 1330753-18-8
CAS 1330753-18-8 is the registry number for 1-(6-Chloropyridazin-3-yl)-4-methyl-1H-pyrrole-3-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
1-(6-chloropyridazin-3-yl)-4-methylpyrrole-3-carboxylic acid (CAS 1330753-18-8) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: 1-(6-chloropyridazin-3-yl)-4-methylpyrrole-3-carboxylic acid. InChIKey: DHYAIDNDUTYMRE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 1-(6-chloropyridazin-3-yl)-4-methylpyrrole-3-carboxylic acid |
| InChIKey | DHYAIDNDUTYMRE-UHFFFAOYSA-N |
| SMILES | CC1=CN(C=C1C(=O)O)C2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)