CAS 1331822-32-2 appears in our catalog under these names: Olopatadine Impurity F, Alpha-Hydroxy Olopatadine, Olopatadine Impurity 1(Olopatadine USP RC A), Alpha-Hydroxy Olopatadine (>90%), >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
2-[(11Z)-11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]-2-hydroxyacetic acid (CAS 1331822-32-2) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: 2-[(11Z)-11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]-2-hydroxyacetic acid. InChIKey: WPDCFRNNHUYQGW-IUXPMGMMSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 2-[(11Z)-11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]-2-hydroxyacetic acid |
| InChIKey | WPDCFRNNHUYQGW-IUXPMGMMSA-N |
| SMILES | CN(C)CC/C=C\1/C2=CC=CC=C2COC3=C1C=C(C=C3)C(C(=O)O)O |
Computed by PubChem (NCBI)