Products 1332530-33-2
CAS 1332530-33-2 appears in our catalog under these names: 1-(4-Aminophenyl)-2-nitropropane hydrochloride, 1-(4-Aminophenyl)-2-nitropropane hydroch, loride, 100 mg, 1-(4-Aminophenyl)-2-nitropropane hydroch, loride, 50 mg, 1-(4-Aminophenyl)-2-nitropropane hydroch, loride, 250 mg, 1-(4-Aminophenyl)-2-nitropropane hydroch, loride, 500 mg. Offered by: Biosynth, Roth. Available pack sizes: 250mg, 500mg, 1000mg, 100mg, 50mg, 1g.
4-(2-nitropropyl)aniline;hydrochloride (CAS 1332530-33-2) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 4-(2-nitropropyl)aniline;hydrochloride. InChIKey: CBRPIJWFMFQCGT-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 4-(2-nitropropyl)aniline;hydrochloride |
| InChIKey | CBRPIJWFMFQCGT-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)