CAS 1332765-79-3 appears in our catalog under these names: 3-(3-bromophenyl)oxetan-3-amine hcl, 3-Amino-3-(3-bromophenyl)oxetane hydrochloride, 95%, 3-(3-Bromophenyl)oxetan-3-amine hydrochloride, 97%, 3-(3-Bromophenyl)oxetan-3-amine hydrochloride, 96%, 96%. Offered by: Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 10g, 5g.
3-(3-bromophenyl)oxetan-3-amine;hydrochloride (CAS 1332765-79-3) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: 3-(3-bromophenyl)oxetan-3-amine;hydrochloride. InChIKey: AVFGETQERDGLCM-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | 3-(3-bromophenyl)oxetan-3-amine;hydrochloride |
| InChIKey | AVFGETQERDGLCM-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC(=CC=C2)Br)N.Cl |
Computed by PubChem (NCBI)