Products 1332920-63-4

CAS 1332920-63-4 is the registry number for 3-(3-Bromophenyl)oxetan-3-amine hydrochloride, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-(3-bromophenyl)oxetan-3-amine;hydrochloride (CAS 1332920-63-4) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: 3-(3-bromophenyl)oxetan-3-amine;hydrochloride. InChIKey: AVFGETQERDGLCM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BrClNO
Molecular weight264.54 g/mol
IUPAC name3-(3-bromophenyl)oxetan-3-amine;hydrochloride
InChIKeyAVFGETQERDGLCM-UHFFFAOYSA-N
SMILESC1C(CO1)(C2=CC(=CC=C2)Br)N.Cl

Computed by PubChem (NCBI)