CAS 676134-73-9 appears in our catalog under these names: 6-Bromoisochroman-4-amine hydrochloride, 95%, 95%, 6-Bromo-3,4-dihydro-1H-isochromen-4-amine hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
6-bromo-3,4-dihydro-1H-isochromen-4-amine;hydrochloride (CAS 676134-73-9) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: 6-bromo-3,4-dihydro-1H-isochromen-4-amine;hydrochloride. InChIKey: ZMGMZLVFQWJVGW-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-1H-isochromen-4-amine;hydrochloride |
| InChIKey | ZMGMZLVFQWJVGW-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(CO1)C=CC(=C2)Br)N.Cl |
Computed by PubChem (NCBI)