CAS 55368-83-7 appears in our catalog under these names: Ethyl 4-bromobenzimidate hydrochloride, 95%, Ethyl 4-bromobenzimidate hydrochloride 97%, Ethyl 4-bromobenzimidate hydrochloride, 97%, 97%, 4-Bromo-benzimidic acid ethyl ester, hydrochloride, 90%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
Ethyl 4-bromobenzenecarboximidate;hydrochloride (CAS 55368-83-7) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: ethyl 4-bromobenzenecarboximidate;hydrochloride. InChIKey: SWJFEVFZCZJOOE-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | ethyl 4-bromobenzenecarboximidate;hydrochloride |
| InChIKey | SWJFEVFZCZJOOE-UHFFFAOYSA-N |
| SMILES | CCOC(=N)C1=CC=C(C=C1)Br.Cl |
Computed by PubChem (NCBI)