CAS 1707367-41-6 is the registry number for 3-(3-Bromophenoxy)azetidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3-bromophenoxy)azetidine;hydrochloride (CAS 1707367-41-6) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: 3-(3-bromophenoxy)azetidine;hydrochloride. InChIKey: JHYJTLKCOAOSME-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | 3-(3-bromophenoxy)azetidine;hydrochloride |
| InChIKey | JHYJTLKCOAOSME-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)