CAS 133307-45-6 appears in our catalog under these names: Imidazo(1,2-a)quinoxalin-4(5H)-one, 95%, 4H,5H-Imidazo(1,2-a)quinoxalin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5H-imidazo[1,2-a]quinoxalin-4-one (CAS 133307-45-6) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 5H-imidazo[1,2-a]quinoxalin-4-one. InChIKey: YTEOFXCKOQBQRA-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 5H-imidazo[1,2-a]quinoxalin-4-one |
| InChIKey | YTEOFXCKOQBQRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C3=NC=CN23 |
Computed by PubChem (NCBI)