Products 13333-86-3
CAS 13333-86-3 appears in our catalog under these names: (Biphenyl-4-yloxy)-acetic acid, 98%, 2-((1,1'-Biphenyl)-4-yloxy)acetic acid, 95-<97%, 2-((1,1'-Biphenyl)-4-yloxy)acetic acid, ≥97-<99%, 2-([1,1'-Biphenyl]-4-yloxy)acetic acid, 97%, 97%, (Biphenyl-4-yloxy)acetic acid, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 50g, 100g, 200g.
2-(4-phenylphenoxy)acetic acid (CAS 13333-86-3) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2-(4-phenylphenoxy)acetic acid. InChIKey: UEXMWDXKHUIBSJ-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2-(4-phenylphenoxy)acetic acid |
| InChIKey | UEXMWDXKHUIBSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-phenylphenoxy)acetic acid, (biphenyl-4-yloxy)acetic acid, 2-([1,1'-biphenyl]-4-yloxy)acetic acid, (Biphenyl-4-yloxy)-acetic acid, (4-biphenylyloxy)acetic acid, (1,1'-biphenyl-4-yloxy)acetic acid, 2-{[1,1'-biphenyl]-4-yloxy}acetic acid, 2-([1,1'-Biphenyl]-4-yloxy)-acetic acid, Acetic acid, 2-([1,1'-biphenyl]-4-yloxy)-, 2-(Biphenyl-4-yloxy)acetic acid