Products 1333325-25-9
CAS 1333325-25-9 appears in our catalog under these names: L-3,6-Bis(b-chloroethyl)-2,5-diketopiperazine, >95% (HPLC), L-3,6-Bis(beta-chloroethyl)-2,5-diketopiperazine, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5g, 250mg.
(3S,6S)-3,6-bis(2-chloroethyl)piperazine-2,5-dione (CAS 1333325-25-9) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: (3S,6S)-3,6-bis(2-chloroethyl)piperazine-2,5-dione. InChIKey: USWJWDYDLDQLDK-WDSKDSINSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | (3S,6S)-3,6-bis(2-chloroethyl)piperazine-2,5-dione |
| InChIKey | USWJWDYDLDQLDK-WDSKDSINSA-N |
| SMILES | C(CCl)[C@H]1C(=O)N[C@H](C(=O)N1)CCCl |
Computed by PubChem (NCBI)