Products 1333642-90-2
CAS 1333642-90-2 is the registry number for 2-Amino-1-(2,6-difluorophenyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-1-(2,6-difluorophenyl)ethanol;hydrochloride (CAS 1333642-90-2) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: 2-amino-1-(2,6-difluorophenyl)ethanol;hydrochloride. InChIKey: LVDXAOPWUUSATR-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | 2-amino-1-(2,6-difluorophenyl)ethanol;hydrochloride |
| InChIKey | LVDXAOPWUUSATR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(CN)O)F.Cl |
Computed by PubChem (NCBI)