Products 1334532-17-0
CAS 1334532-17-0 appears in our catalog under these names: Acetyl L-Carnitine-d3 Hydrochloride, Acetyl-L-carnitine-d3 HCl (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Acetyl L-Carnitine-d3 Chloride, Acetyl–L–carnitine–d3 hydrochloride, Acetyl-L-carnitine-d3 (hydrochloride), 99.79%. Offered by: TRC, CDN, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 0,05g, 0,01g, 1mg, 5mg, 10mg, 1 mg, 5 mg.
[(2R)-2-acetyloxy-3-carboxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride (CAS 1334532-17-0) is a chemical compound with the molecular formula C9H18ClNO4 and a molecular weight of 242.71 g/mol. IUPAC name: [(2R)-2-acetyloxy-3-carboxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride. InChIKey: JATPLOXBFFRHDN-WVKKGGDISA-N.
| Molecular formula | C9H18ClNO4 |
|---|---|
| Molecular weight | 242.71 g/mol |
| IUPAC name | [(2R)-2-acetyloxy-3-carboxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride |
| InChIKey | JATPLOXBFFRHDN-WVKKGGDISA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)C.[Cl-] |
Computed by PubChem (NCBI)