CAS 34582-30-4 appears in our catalog under these names: (S)-1-tert-Butyl 4-methyl 2-aminosuccinate hydrochloride, 97%, (S)–1–tert–Butyl 4–methyl 2–aminosuccinate hydrochloride, (S)-1-tert-Butyl 4-methyl 2-aminosuccinate hydrochloride, 97%, 97%, (S)-1-tert-Butyl 4-methyl 2-aminosuccinate hydrochloride, 95%, H-Asp(OMe)-OtBu·HCl, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 100g, 10g, 1g, 250mg, 500g, 15g.
1-O-tert-butyl 4-O-methyl (2S)-2-aminobutanedioate;hydrochloride (CAS 34582-30-4) is a chemical compound with the molecular formula C9H18ClNO4 and a molecular weight of 239.69 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (2S)-2-aminobutanedioate;hydrochloride. InChIKey: FGBVDHWVRGDHRV-RGMNGODLSA-N.
| Molecular formula | C9H18ClNO4 |
|---|---|
| Molecular weight | 239.69 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (2S)-2-aminobutanedioate;hydrochloride |
| InChIKey | FGBVDHWVRGDHRV-RGMNGODLSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)OC)N.Cl |
Computed by PubChem (NCBI)