CAS 5297-17-6 appears in our catalog under these names: {2-[(3-carboxypropanoyl)oxy]ethyl}trimethylazanium chloride, 95%, Succinyl Monocholine Chloride, {2-((3-Carboxypropanoyl)oxy)ethyl}trimethylazanium Chloride, >95% (HPLC), Succinylmonocholine Chloride, 2–((3–Carboxypropanoyl)oxy)–N,N,N–trimethylethanaminium chloride. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 25g, 5g, 1g, 250mg, on request, 100mg, 500mg, 50mg.
2-(3-carboxypropanoyloxy)ethyl-trimethylazanium chloride (CAS 5297-17-6) is a chemical compound with the molecular formula C9H18ClNO4 and a molecular weight of 239.69 g/mol. IUPAC name: 2-(3-carboxypropanoyloxy)ethyl-trimethylazanium chloride. InChIKey: LDHMZIUMVSRSIK-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO4 |
|---|---|
| Molecular weight | 239.69 g/mol |
| IUPAC name | 2-(3-carboxypropanoyloxy)ethyl-trimethylazanium chloride |
| InChIKey | LDHMZIUMVSRSIK-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCOC(=O)CCC(=O)O.[Cl-] |
Computed by PubChem (NCBI)