CAS 2673-19-0 appears in our catalog under these names: H-L-Asp(OtBu)-OMe*HCl, L-Aspartic acid 4-tert-butyl 1-methyl ester hydrochloride, 9, H-Asp(OtBu)-OMe·HCl 95%, 4-tert-Butyl 1-methyl L-aspartate hydrochloride, 95%, 95%, H-Asp(OtBu)-OMe.HCl, 95%. Offered by: Iris Biotech, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 50g.
4-O-tert-butyl 1-O-methyl (2S)-2-aminobutanedioate;hydrochloride (CAS 2673-19-0) is a chemical compound with the molecular formula C9H18ClNO4 and a molecular weight of 239.69 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl (2S)-2-aminobutanedioate;hydrochloride. InChIKey: SFYKWYAIJZEDNG-RGMNGODLSA-N.
| Molecular formula | C9H18ClNO4 |
|---|---|
| Molecular weight | 239.69 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl (2S)-2-aminobutanedioate;hydrochloride |
| InChIKey | SFYKWYAIJZEDNG-RGMNGODLSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)