Products 144313-55-3
CAS 144313-55-3 appears in our catalog under these names: H-Glu-OtBu hydrochloride, 95%, H–Glu–OtBu·HCl, H-Glu-OtBu·HCl 98%, H-Glu-OtBu.HCl, 98%, 98%, (S)-4-Amino-5-(tert-butoxy)-5-oxopentanoic acid hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
(4S)-4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;hydrochloride (CAS 144313-55-3) is a chemical compound with the molecular formula C9H18ClNO4 and a molecular weight of 239.69 g/mol. IUPAC name: (4S)-4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;hydrochloride. InChIKey: RKBSTOCWFXYRNS-RGMNGODLSA-N.
| Molecular formula | C9H18ClNO4 |
|---|---|
| Molecular weight | 239.69 g/mol |
| IUPAC name | (4S)-4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;hydrochloride |
| InChIKey | RKBSTOCWFXYRNS-RGMNGODLSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-Glu-OtBu.HCl, (S)-4-Amino-5-(tert-butoxy)-5-oxopentanoic acid hydrochloride, H-Glu-Otbu HCl, H-Glu-OtBu hydrochloride, (4S)-4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid;hydrochloride, L-Glutamic acid 1-tert-Butyl ester hydrochloride, L-Glu-OtBu*HCl, L-Glutamic acid alpha-tert-butyl ester hydrochloride, (s)-4-amino-5-(tert-butoxy)-5-oxopentanoic acid hcl, H-Glu-OtBu inverted exclamation mark currencyHCl