CAS 2504-11-2 appears in our catalog under these names: Acetyl-dl-carnitine hydrochloride, 95%, (±)-Acetylcarnitine Chloride, >95% (HPLC), (±)–Acetylcarnitine chloride, Acetyl–DL–carnitine (chloride), ACETYL-DL-CARNITINE HCL CRYSTALLINE. Offered by: Combi-blocks, TRC, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 100mg, 10mg, 50mg, 250mg, 500mg, 5 mg.
(2-acetyloxy-3-carboxypropyl)-trimethylazanium chloride (CAS 2504-11-2) is a chemical compound with the molecular formula C9H18ClNO4 and a molecular weight of 239.69 g/mol. IUPAC name: (2-acetyloxy-3-carboxypropyl)-trimethylazanium chloride. InChIKey: JATPLOXBFFRHDN-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO4 |
|---|---|
| Molecular weight | 239.69 g/mol |
| IUPAC name | (2-acetyloxy-3-carboxypropyl)-trimethylazanium chloride |
| InChIKey | JATPLOXBFFRHDN-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)