CAS 63329-02-2 appears in our catalog under these names: H-D-Asp(OtBu)-OMe*HCl, (R)-4-tert-Butyl 1-methyl 2-aminosuccinate hydrochloride, 95%, 95%, (R)-4-tert-Butyl 1-methyl 2-aminosuccinate hydrochloride, 97%, H-D-Asp(OtBu)-OMe·HCl, 95%. Offered by: Iris Biotech, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 100g, 100mg, 250mg, 5g, 10g.
4-O-tert-butyl 1-O-methyl (2R)-2-aminobutanedioate;hydrochloride (CAS 63329-02-2) is a chemical compound with the molecular formula C9H18ClNO4 and a molecular weight of 239.69 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl (2R)-2-aminobutanedioate;hydrochloride. InChIKey: SFYKWYAIJZEDNG-FYZOBXCZSA-N.
| Molecular formula | C9H18ClNO4 |
|---|---|
| Molecular weight | 239.69 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl (2R)-2-aminobutanedioate;hydrochloride |
| InChIKey | SFYKWYAIJZEDNG-FYZOBXCZSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)