Products 133578-40-2

CAS 133578-40-2 is the registry number for Methyl 4-acetyl-2-methyl-5-oxohexanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 4-acetyl-2-methyl-5-oxohexanoate (CAS 133578-40-2) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: methyl 4-acetyl-2-methyl-5-oxohexanoate. InChIKey: DIIPTRHCRHVEEI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O4
Molecular weight200.23 g/mol
IUPAC namemethyl 4-acetyl-2-methyl-5-oxohexanoate
InChIKeyDIIPTRHCRHVEEI-UHFFFAOYSA-N
SMILESCC(CC(C(=O)C)C(=O)C)C(=O)OC

Computed by PubChem (NCBI)