CAS 13363-69-4 appears in our catalog under these names: 3-Phenyl-1,2-thiazole-5-carboxylic Acid, 3-Phenyl-1,2-thiazole-5-carboxylic acid, 95%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-phenyl-1,2-thiazole-5-carboxylic acid (CAS 13363-69-4) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 3-phenyl-1,2-thiazole-5-carboxylic acid. InChIKey: IEGXCDUXWSIMOK-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 3-phenyl-1,2-thiazole-5-carboxylic acid |
| InChIKey | IEGXCDUXWSIMOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=C2)C(=O)O |
Computed by PubChem (NCBI)