Products 133740-30-4
CAS 133740-30-4 appears in our catalog under these names: 2,7-Phenanthrenediol, 1-[(4-hydroxyphenyl)methyl]-4-methoxy-, ≥95%, BChE-IN-11, 98.78%. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 1 mg, 10 mg, 5 mg.
1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol (CAS 133740-30-4) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol. InChIKey: XCJSWJPRPDMYLS-UHFFFAOYSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol |
| InChIKey | XCJSWJPRPDMYLS-UHFFFAOYSA-N |
| SMILES | COC1=C2C3=C(C=CC2=C(C(=C1)O)CC4=CC=C(C=C4)O)C=C(C=C3)O |
Computed by PubChem (NCBI)