Products 1337882-43-5
CAS 1337882-43-5 is the registry number for Thieno[2,3-d]pyrimidine-6-carboxylic acid, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
Thieno[2,3-d]pyrimidine-6-carboxylic acid (CAS 1337882-43-5) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: thieno[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: HACJQZHGTLOKSH-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | thieno[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | HACJQZHGTLOKSH-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=NC=NC=C21)C(=O)O |
Computed by PubChem (NCBI)