CAS 1340272-93-6 is the registry number for 2-Amino-N-phenyl-1,3-thiazole-4-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-N-phenyl-1,3-thiazole-4-carboxamide (CAS 1340272-93-6) is a chemical compound with the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. IUPAC name: 2-amino-N-phenyl-1,3-thiazole-4-carboxamide. InChIKey: FHSQXKSCDPRDRB-UHFFFAOYSA-N.
| Molecular formula | C10H9N3OS |
|---|---|
| Molecular weight | 219.27 g/mol |
| IUPAC name | 2-amino-N-phenyl-1,3-thiazole-4-carboxamide |
| InChIKey | FHSQXKSCDPRDRB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CSC(=N2)N |
Computed by PubChem (NCBI)