CAS 1341926-94-0 appears in our catalog under these names: Ethyl 2,2-difluoro-2-(6-methylpyridin-3-yl)acetate, 95%, Ethyl 2,2-difluoro-2-(6-methylpyridin-3-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
Ethyl 2,2-difluoro-2-(6-methyl-3-pyridinyl)acetate (CAS 1341926-94-0) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(6-methyl-3-pyridinyl)acetate. InChIKey: ZXADEANRRGOUFQ-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-(6-methyl-3-pyridinyl)acetate |
| InChIKey | ZXADEANRRGOUFQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CN=C(C=C1)C)(F)F |
Computed by PubChem (NCBI)