Products 134292-57-2
CAS 134292-57-2 is the registry number for 1-(tert-Butyl) 4-methyl 2-methylenesuccinate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
1-O-tert-butyl 4-O-methyl 2-methylidenebutanedioate (CAS 134292-57-2) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 2-methylidenebutanedioate. InChIKey: SEEQECCFBDURSZ-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 2-methylidenebutanedioate |
| InChIKey | SEEQECCFBDURSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=C)CC(=O)OC |
Computed by PubChem (NCBI)