Products 1343107-31-2
CAS 1343107-31-2 appears in our catalog under these names: 2，2–difluoro–2–(2–(trifluoromethyl)phenyl)acetic acid, 2,2-Difluoro-2-(2-(trifluoromethyl)phenyl)acetic acid, 2,2-Difluoro-2-[2-(trifluoromethyl)phenyl]acetic acid, 2,2-Difluoro-2-[2-(trifluoromethyl)phenyl]acetic acid, 92%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 0,5g, 10mg, 50mg.
2,2-difluoro-2-[2-(trifluoromethyl)phenyl]acetic acid (CAS 1343107-31-2) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 2,2-difluoro-2-[2-(trifluoromethyl)phenyl]acetic acid. InChIKey: XXGYJZCVWVRSGB-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 2,2-difluoro-2-[2-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | XXGYJZCVWVRSGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)