CAS 1343305-64-5 is the registry number for 5-(3,5-Dichlorophenyl)-1,2,4-oxadiazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(3,5-dichlorophenyl)-1,2,4-oxadiazol-3-amine (CAS 1343305-64-5) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 5-(3,5-dichlorophenyl)-1,2,4-oxadiazol-3-amine. InChIKey: GUFWSKDRPKCDQH-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 5-(3,5-dichlorophenyl)-1,2,4-oxadiazol-3-amine |
| InChIKey | GUFWSKDRPKCDQH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=NC(=NO2)N |
Computed by PubChem (NCBI)