Products 1343441-16-6
CAS 1343441-16-6 is the registry number for 2-(Chloromethyl)-1,3-difluoro-5-nitrobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-1,3-difluoro-5-nitrobenzene (CAS 1343441-16-6) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 2-(chloromethyl)-1,3-difluoro-5-nitrobenzene. InChIKey: NLMBHJGUMXZHHE-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO2 |
|---|---|
| Molecular weight | 207.56 g/mol |
| IUPAC name | 2-(chloromethyl)-1,3-difluoro-5-nitrobenzene |
| InChIKey | NLMBHJGUMXZHHE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CCl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)