Products 1343857-33-9

CAS 1343857-33-9 is the registry number for 4,4,4-Trifluoro-3-(morpholin-4-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4,4,4-trifluoro-3-morpholin-4-ylbutanoic acid (CAS 1343857-33-9) is a chemical compound with the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. IUPAC name: 4,4,4-trifluoro-3-morpholin-4-ylbutanoic acid. InChIKey: XEIUHORPSKGOAD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12F3NO3
Molecular weight227.18 g/mol
IUPAC name4,4,4-trifluoro-3-morpholin-4-ylbutanoic acid
InChIKeyXEIUHORPSKGOAD-UHFFFAOYSA-N
SMILESC1COCCN1C(CC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)