CAS 2126162-15-8 is the registry number for 3-(Prop-2-en-1-yl)azetidin-3-ol, trifluoroacetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-prop-2-enylazetidin-3-ol;2,2,2-trifluoroacetic acid (CAS 2126162-15-8) is a chemical compound with the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. IUPAC name: 3-prop-2-enylazetidin-3-ol;2,2,2-trifluoroacetic acid. InChIKey: CWKNASPSWSDRQA-UHFFFAOYSA-N.
| Molecular formula | C8H12F3NO3 |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 3-prop-2-enylazetidin-3-ol;2,2,2-trifluoroacetic acid |
| InChIKey | CWKNASPSWSDRQA-UHFFFAOYSA-N |
| SMILES | C=CCC1(CNC1)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)