CAS 1434126-93-8 appears in our catalog under these names: (2S)-2-Methylpiperidin-4-one trifluoroacetic acid, 95%, (S)-2-Methylpiperidin-4-one 2,2,2-trifluoroacetate, 97%, 97%, (2S)-2-METHYL-4-PIPERIDONE TFA, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 10g.
(2S)-2-methylpiperidin-4-one;2,2,2-trifluoroacetic acid (CAS 1434126-93-8) is a chemical compound with the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. IUPAC name: (2S)-2-methylpiperidin-4-one;2,2,2-trifluoroacetic acid. InChIKey: QGYSTDMFHTYSAV-JEDNCBNOSA-N.
| Molecular formula | C8H12F3NO3 |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | (2S)-2-methylpiperidin-4-one;2,2,2-trifluoroacetic acid |
| InChIKey | QGYSTDMFHTYSAV-JEDNCBNOSA-N |
| SMILES | C[C@H]1CC(=O)CCN1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)