CAS 1392804-83-9 is the registry number for 1–Oxa–6–azaspiro(3·4)octane 2,2,2–trifluoroacetate. Offered by: GLPBio. Available pack sizes: 1g.
1-oxa-7-azaspiro[3.4]octane;2,2,2-trifluoroacetic acid (CAS 1392804-83-9) is a chemical compound with the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. IUPAC name: 1-oxa-7-azaspiro[3.4]octane;2,2,2-trifluoroacetic acid. InChIKey: JQHIQHPMJARUCS-UHFFFAOYSA-N.
| Molecular formula | C8H12F3NO3 |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 1-oxa-7-azaspiro[3.4]octane;2,2,2-trifluoroacetic acid |
| InChIKey | JQHIQHPMJARUCS-UHFFFAOYSA-N |
| SMILES | C1CNCC12CCO2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)