CAS 299182-32-4 is the registry number for (R)-6-Methylpiperidin-3-one 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6R)-6-methylpiperidin-3-one;2,2,2-trifluoroacetic acid (CAS 299182-32-4) is a chemical compound with the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. IUPAC name: (6R)-6-methylpiperidin-3-one;2,2,2-trifluoroacetic acid. InChIKey: QUPWAGGKBYWZCP-NUBCRITNSA-N.
| Molecular formula | C8H12F3NO3 |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | (6R)-6-methylpiperidin-3-one;2,2,2-trifluoroacetic acid |
| InChIKey | QUPWAGGKBYWZCP-NUBCRITNSA-N |
| SMILES | C[C@@H]1CCC(=O)CN1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)