Products 407-91-0

CAS 407-91-0 is the registry number for 6-(N-Trifluoroacetyl)aminocaproic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg, 50mg.

Structural formula: {0} (CAS {1})

6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (CAS 407-91-0) is a chemical compound with the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. IUPAC name: 6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid. InChIKey: FGUZMCXMRNWZPT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12F3NO3
Molecular weight227.18 g/mol
IUPAC name6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid
InChIKeyFGUZMCXMRNWZPT-UHFFFAOYSA-N
SMILESC(CCC(=O)O)CCNC(=O)C(F)(F)F

Computed by PubChem (NCBI)