Products 21735-55-7

CAS 21735-55-7 is the registry number for Nirmatrelvir Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid (CAS 21735-55-7) is a chemical compound with the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. IUPAC name: 3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid. InChIKey: FCTPLAZWXGEGKO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12F3NO3
Molecular weight227.18 g/mol
IUPAC name3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid
InChIKeyFCTPLAZWXGEGKO-UHFFFAOYSA-N
SMILESCC(C)(C)C(C(=O)O)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)