CAS 21735-55-7 is the registry number for Nirmatrelvir Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid (CAS 21735-55-7) is a chemical compound with the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. IUPAC name: 3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid. InChIKey: FCTPLAZWXGEGKO-UHFFFAOYSA-N.
| Molecular formula | C8H12F3NO3 |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
| InChIKey | FCTPLAZWXGEGKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)