CAS 1344895-43-7 is the registry number for 8-Bromo-7-hydroxychroman-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-7-hydroxy-2,3-dihydrochromen-4-one (CAS 1344895-43-7) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 8-bromo-7-hydroxy-2,3-dihydrochromen-4-one. InChIKey: MGOWVTKFYPAGPY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 8-bromo-7-hydroxy-2,3-dihydrochromen-4-one |
| InChIKey | MGOWVTKFYPAGPY-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=C2Br)O |
Computed by PubChem (NCBI)