Products 134640-74-7
CAS 134640-74-7 appears in our catalog under these names: 6-Fluoro-1-methyl-2,3-dihydro-1H-indole-2,3-dione, 6-Fluoro-1-methylindoline-2,3-dione 97%, 6-Fluoro-1-methylindoline-2,3-dione, 97%, 97%, 6-Fluoro-1-methyl-2,3-dihydro-1h-indole-2,3-dione, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g.
6-fluoro-1-methylindole-2,3-dione (CAS 134640-74-7) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-1-methylindole-2,3-dione. InChIKey: BDMHRNWVOHIJLN-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-1-methylindole-2,3-dione |
| InChIKey | BDMHRNWVOHIJLN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)F)C(=O)C1=O |
Computed by PubChem (NCBI)