CAS 1346604-68-9 appears in our catalog under these names: Fesoterodine Impurity 3 HCl, 3-(3-Aminopropyl)benzoic Acid Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
3-(3-aminopropyl)benzoic acid;hydrochloride (CAS 1346604-68-9) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 3-(3-aminopropyl)benzoic acid;hydrochloride. InChIKey: MLHQSMUQVWLINA-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 3-(3-aminopropyl)benzoic acid;hydrochloride |
| InChIKey | MLHQSMUQVWLINA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CCCN.Cl |
Computed by PubChem (NCBI)